CymitQuimica logo

CAS 6032-92-4

:

2,6-Dideoxy-3-C-methyl-L-ribo-hexose

Description:
2,6-Dideoxy-3-C-methyl-L-ribo-hexose is a carbohydrate that belongs to the class of deoxy sugars, specifically a hexose derivative. This compound features a ribose-like structure with two hydroxyl groups replaced by hydrogen atoms, which contributes to its unique properties. The presence of a methyl group at the 3-position enhances its stability and alters its reactivity compared to other sugars. It is typically found in certain natural products and may play a role in biological systems, particularly in the context of glycosylation reactions. The compound is characterized by its ability to participate in various chemical reactions, including those involving glycosidic bond formation. Its stereochemistry is significant, as the L-configuration indicates the orientation of the hydroxyl groups in relation to the reference molecule, which can influence its biological activity. Overall, 2,6-Dideoxy-3-C-methyl-L-ribo-hexose is of interest in both synthetic chemistry and biochemistry due to its structural features and potential applications in drug development and metabolic studies.
Formula:C7H14O4
InChI:InChI=1S/C7H14O4/c1-5(9)6(10)7(2,11)3-4-8/h4-6,9-11H,3H2,1-2H3/t5-,6-,7+/m0/s1
InChI key:InChIKey=JYAQWANEOPJVEY-LYFYHCNISA-N
SMILES:[C@@H]([C@](CC=O)(C)O)([C@H](C)O)O
Synonyms:
  • 2,6-Dideoxy-3-C-methyl-L-ribo-hexose
  • Mycarose
  • L-ribo-Hexose, 2,6-dideoxy-3-C-methyl-
  • L-Mycarose
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.