CAS 6033-69-8
:6-amino-4-(1-ethylpropyl)-3-phenyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Description:
6-amino-4-(1-ethylpropyl)-3-phenyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile, with the CAS number 6033-69-8, is a complex organic compound characterized by its unique structural features, including a dihydropyrano-pyrazole framework. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the amino group and the carbonitrile moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its phenyl and ethylpropyl substituents contribute to its hydrophobic characteristics, which can influence its interaction with biological targets. The compound's structure may also allow for diverse functionalization, enhancing its potential applications in pharmaceuticals or agrochemicals. Overall, the unique combination of functional groups and structural elements in this compound positions it as a candidate for further research in drug development and synthetic chemistry.
Formula:C18H20N4O
InChI:InChI=1/C18H20N4O/c1-3-11(4-2)14-13(10-19)17(20)23-18-15(14)16(21-22-18)12-8-6-5-7-9-12/h5-9,11,14H,3-4,20H2,1-2H3,(H,21,22)
Synonyms:- pyrano[2,3-c]pyrazole-5-carbonitrile, 6-amino-4-(1-ethylpropyl)-1,4-dihydro-3-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Deserpidine hydrochloride
CAS:Deserpidine hydrochloride is an antihypertensive, ACE-inhibiting drug derived from Rauwolfia, reducing blood pressure and aldosterone secretion.Formula:C32H39ClN2O8Color and Shape:SolidMolecular weight:615.12
