CymitQuimica logo

CAS 603306-52-1

:

5-fluoro-1H-indole-7-carbaldehyde

Description:
5-Fluoro-1H-indole-7-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position and an aldehyde functional group at the 7-position contributes to its unique reactivity and properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The aldehyde group allows for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, the fluorine atom can enhance the compound's biological activity and lipophilicity, influencing its pharmacokinetic properties. As with many indole derivatives, 5-fluoro-1H-indole-7-carbaldehyde may exhibit interesting biological activities, including antimicrobial or anticancer properties, which are subjects of ongoing research. Proper handling and storage are essential due to its reactive nature and potential toxicity.
Formula:C9H6FNO
InChI:InChI=1/C9H6FNO/c10-8-3-6-1-2-11-9(6)7(4-8)5-12/h1-5,11H
InChI key:ACKRNKKYYJVPEP-UHFFFAOYSA-N
SMILES:c1c[nH]c2c1cc(cc2C=O)F
Synonyms:
  • 1H-indole-7-carboxaldehyde, 5-fluoro-
  • 5-Fluoro-indole-7-carboxaldehyde
  • 5-Fluoro-1H-indole-7-carbaldehyde
Found 3 products.