CAS 60342-79-2
:1-Deoxy-1-[(5H-dibenz[b,f]azepin-5-ylcarbonyl)amino]-β-D-glucopyranuronic acid
Description:
1-Deoxy-1-[(5H-dibenz[b,f]azepin-5-ylcarbonyl)amino]-β-D-glucopyranuronic acid is a complex organic compound characterized by its unique structural features, which include a glucopyranuronic acid moiety and a dibenzazepine derivative. The presence of the dibenz[b,f]azepine ring system contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The glucopyranuronic acid component suggests that the substance may exhibit properties related to carbohydrate chemistry, such as solubility in water and potential interactions with biological macromolecules. The compound's specific functional groups, including the carbonyl and amino groups, may influence its reactivity and interactions in biological systems. Overall, this compound's intricate structure and functional characteristics make it a subject of interest in medicinal chemistry and drug development, particularly in the context of exploring its therapeutic potential and mechanisms of action. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C21H20N2O7
InChI:InChI=1/C21H20N2O7/c24-15-16(25)18(20(27)28)30-19(17(15)26)22-21(29)23-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)23/h1-10,15-19,24-26H,(H,22,29)(H,27,28)/t15-,16-,17+,18-,19?/m0/s1
InChI key:InChIKey=VKZWFMGCAPKSML-QXCZDIPSSA-N
SMILES:C(N[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O)(=O)N2C=3C(C=CC=4C2=CC=CC4)=CC=CC3
Synonyms:- Carbamazepine N-glucuronide
- 1-Deoxy-1-[(5H-dibenz[b,f]azepin-5-ylcarbonyl)amino]-β-D-glucopyranuronic acid
- β-D-Glucopyranuronic acid, 1-deoxy-1-[(5H-dibenz[b,f]azepin-5-ylcarbonyl)amino]-
- 5H-Dibenz[b,f]azepine, β-D-glucopyranuronic acid deriv.
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Carbamazepine N-Glucuronide Sodium
CAS:Controlled ProductFormula:C21H19N2O7·NaColor and Shape:NeatMolecular weight:412.393N-Glucuronide Carbamazepine-D₁₀
CAS:Controlled ProductFormula:C21D10H10N2O7Color and Shape:NeatMolecular weight:422.454
