
CAS 60347-67-3
:Batatasin IV
Description:
Batatasin IV is a naturally occurring compound classified as a phenolic compound, specifically a type of stilbene. It is primarily derived from the sweet potato (Ipomoea batatas) and is known for its potential health benefits, including antioxidant and anti-inflammatory properties. The molecular structure of Batatasin IV features a biphenyl core with hydroxyl groups, which contribute to its biological activity. This compound has garnered interest in the field of nutrition and pharmacology due to its ability to modulate various cellular processes. Research indicates that Batatasin IV may play a role in protecting against oxidative stress and could have implications in the prevention of chronic diseases. Additionally, its presence in sweet potatoes highlights the nutritional value of this root vegetable, making it a subject of interest for studies related to diet and health. Overall, Batatasin IV exemplifies the significance of phytochemicals in promoting health and well-being.
Formula:C15H16O3
InChI:InChI=1S/C15H16O3/c1-18-14-9-11(8-13(16)10-14)6-7-12-4-2-3-5-15(12)17/h2-5,8-10,16-17H,6-7H2,1H3
InChI key:InChIKey=IUMFLNFLJUUODE-UHFFFAOYSA-N
SMILES:C(CC1=C(O)C=CC=C1)C2=CC(OC)=CC(O)=C2
Synonyms:- 3-[2-(2-Hydroxyphenyl)ethyl]-5-methoxyphenol
- Batatasin IV
- Phenol, 3-[2-(2-hydroxyphenyl)ethyl]-5-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA01HPMX
25mgTo inquire50mgTo inquire100mgTo inquire200mgTo inquire1mg191.00€5mg341.00€10mg665.00€Batatasin IV
CAS:Batatasin IV is identified from Dioscorea opposita which is a a type of homologous medicinal plant and is commonly used as food in daily life.Formula:C15H16O3Purity:99.08%Color and Shape:SolidMolecular weight:244.29Ref: TM-TN2444
1mg122.00€1mL*10mM (DMSO)250.00€5mg290.00€10mg420.00€25mg637.00€50mg874.00€100mg1,170.00€200mg1,584.00€Batatasin IV
CAS:Batatasin IV is a steroidal saponin, which is a type of bioactive compound highly regarded in the scientific community for its potential therapeutic properties. It is derived from the rhizomes of certain species of yam, specifically Dioscorea batatas, which is a well-documented source of such biologically active compounds. The mode of action of Batatasin IV involves its interactions at the cellular level, including modulation of signaling pathways that regulate inflammation and cell proliferation. This involves interference with specific enzymes and receptors that are critical in these pathways.Formula:C15H16O3Purity:Min. 95%Molecular weight:244.28 g/mol



