CAS 6035-19-4
:Benzenediazonium, 2-chloro-4-nitro-, 2-naphthalenesulfonate (1:1)
Description:
Benzenediazonium, 2-chloro-4-nitro-, 2-naphthalenesulfonate (1:1), with the CAS number 6035-19-4, is a chemical compound characterized by its diazonium structure, which is known for its reactivity in electrophilic aromatic substitution reactions. This compound features a benzenediazonium group, which is a positively charged species that can readily participate in nucleophilic attacks. The presence of the 2-chloro-4-nitro substituents on the benzene ring introduces both electron-withdrawing and steric effects, influencing its reactivity and stability. The 2-naphthalenesulfonate moiety contributes to the compound's solubility and stability in various solvents. Typically, diazonium salts are sensitive to heat and light, and they can decompose to release nitrogen gas, making them useful in synthetic organic chemistry, particularly in azo dye production. Additionally, the compound's sulfonate group enhances its solubility in water, facilitating its application in various chemical processes. Overall, this compound is significant in synthetic organic chemistry for its utility in coupling reactions and dye synthesis.
Formula:C10H7O3S·C6H3ClN3O2
InChI:InChI=1S/C10H8O3S.C6H3ClN3O2/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;7-5-3-4(10(11)12)1-2-6(5)9-8/h1-7H,(H,11,12,13);1-3H/q;+1/p-1
InChI key:InChIKey=LKBPUFYOZCBOIB-UHFFFAOYSA-M
SMILES:N(=O)(=O)C1=CC(Cl)=C([N+]#N)C=C1.S(=O)(=O)([O-])C1=CC2=C(C=C1)C=CC=C2
Synonyms:- 2-Chloro-4-Nitrobenzenediazonium Naphthalene-2-Sulfonate
- 2-Chloro-4-Nitrobenzenediazonium Naphthalene-2-Sulphonate
- 2-Naphthalenesulfonic acid, 2-chloro-4-nitrobenzenediazonium salt
- 2-Naphthalenesulfonic acid, ion(1-), 2-chloro-4-nitrobenzenediazonium
- Benzenediazonium, 2-chloro-4-nitro-, 2-naphthalenesulfonate
- Benzenediazonium, 2-chloro-4-nitro-, 2-naphthalenesulfonate (1:1)
- NNCD reagent
- NSC 97284
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N.N.C.D.-reagent
CAS:Controlled ProductFormula:C6H3ClN3O2·C10H7O3SColor and Shape:NeatMolecular weight:694.948
