CAS 6035-47-8
:Methanesulfinic acid, hydroxy-, monosodium salt, dihydrate
Description:
Methanesulfinic acid, hydroxy-, monosodium salt, dihydrate, also known by its CAS number 6035-47-8, is a chemical compound characterized by its sulfinic acid functional group, which contains a sulfur atom bonded to a hydroxyl group and a methyl group. This compound typically appears as a white crystalline solid and is soluble in water, making it useful in various applications. The presence of the sodium salt form indicates that it can dissociate in solution to release sodium ions, which can influence its reactivity and solubility. Methanesulfinic acid derivatives are often utilized in organic synthesis, particularly in the production of sulfonamides and other sulfur-containing compounds. Additionally, its dihydrate form suggests that it contains two molecules of water per formula unit, which can affect its stability and handling properties. Overall, this compound is of interest in both industrial and research settings due to its unique chemical properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:CH4O3S·2H2O·Na
InChI:InChI=1S/CH4O3S.Na.2H2O/c2-1-5(3)4;;;/h2H,1H2,(H,3,4);;2*1H2
InChI key:InChIKey=DAYRNFRYENNKCE-UHFFFAOYSA-N
SMILES:S(CO)(=O)O.[Na].O
Synonyms:- Formaldehyde sodium sulfoxylate dihydrate
- Hydroxymethanesulfinic acid monosodium salt dihydrate
- Hydroxymethanesulfinic acid sodium salt dihydrate
- Methanesulfinic acid, hydroxy-, monosodium salt, dihydrate
- Methanesulfinic acid, hydroxy-, sodium salt, dihydrate
- Sodium Formaldehyde Sulfoxylate Hydrate
- Sodium Hydroxymethanesulfinate Dihydrate
- Sodium Sulfinomethanolate Hydrate (1:1:2)
- Sodium hydroxymethanesulfinate hydrate
- Sodium formaldehydesulfoxylate dihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Sodium Hydroxymethanesulfinate Dihydrate
CAS:Formula:CH3NaO3S·2H2OPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:154.11Hydroxymethanesulfinic acid monosodium salt dihydrate
CAS:Hydroxymethanesulfinic acid monosodium salt dihydratePurity:98%Molecular weight:154.12g/molHydroxymethanesulfinic acid monosodium salt dihydrate
CAS:<p>Hydroxymethanesulfinic acid monosodium salt dihydrate (HMSD) is a chemical that can be used to remove sulfoxylate and formaldehyde in wastewater. It can also be used as a polymerization catalyst, an activator for epoxy resins, and as a stabilizer of glycol ethers. HMSD is formed by the reaction of methyl ethyl sulfoxide with copper chloride. This chemical has been shown to have thermal expansion properties and high chemical stability, making it useful for industrial processes involving polymerization or glycol esters.</p>Formula:CH3NaO3S·2H2OPurity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:154.12 g/mol



