CAS 6035-49-0: 6,7,8-Trimethoxycoumarin
Description:6,7,8-Trimethoxycoumarin is a synthetic organic compound belonging to the coumarin family, characterized by its fused benzene and α-pyrone rings. This compound features three methoxy groups (-OCH₃) attached to the 6, 7, and 8 positions of the coumarin structure, which significantly influences its chemical properties and biological activities. It typically appears as a pale yellow to white crystalline solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. 6,7,8-Trimethoxycoumarin exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Its structure allows for interactions with various biological targets, and it may also serve as a precursor for the synthesis of other bioactive compounds. Safety data indicates that, like many organic compounds, it should be handled with care, as its effects on human health and the environment are still being studied.
Formula:C12H12O5
InChI:InChI=1S/C12H12O5/c1-14-8-6-7-4-5-9(13)17-10(7)12(16-3)11(8)15-2/h4-6H,1-3H3
InChI key:InChIKey=RAYQKHLZHPFYEJ-UHFFFAOYSA-N
SMILES:O=C1OC=2C(OC)=C(OC)C(OC)=CC2C=C1
- Synonyms:
- 2H-1-Benzopyran-2-one, 5,6,7-trimethoxy-
- 2H-1-Benzopyran-2-one, 6,7,8-trimethoxy-
- 5,6,7-Trimethoxycoumarin
- 6,7,8-Trimethoxy-2H-1-benzopyran-2-one
- 6,7,8-Trimethoxy-2H-benzopyran-2-one
- 6,7,8-Trimethoxycoumarin
- 7,8,9-Trimethoxycoumarin
- Coumarin, 6,7,8-trimethoxy-
- Dimethylfraxetin
- Fraxetin dimethyl ether
- See more synonyms
