
CAS 6036-75-5
:L-erythro-Sphingosine
Description:
L-erythro-Sphingosine, also known as sphinganine, is a long-chain amino alcohol that serves as a fundamental building block for sphingolipids, which are essential components of cell membranes. This compound is characterized by its aliphatic structure, featuring a long hydrocarbon chain with a primary amino group and two hydroxyl groups. It is typically found in various biological systems, particularly in animal tissues, where it plays a crucial role in cellular signaling and membrane integrity. L-erythro-Sphingosine is known for its involvement in the regulation of cell growth, differentiation, and apoptosis. The compound exhibits amphipathic properties, allowing it to interact with both hydrophilic and hydrophobic environments, which is vital for its function in lipid bilayers. Additionally, it can be phosphorylated to form sphingosine-1-phosphate, a significant signaling molecule in various physiological processes. Due to its biological importance, L-erythro-Sphingosine is of interest in research related to neurobiology, cancer, and metabolic disorders.
Formula:C18H37NO2
InChI:InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/b15-14+/t17-,18+/m1/s1
InChI key:InChIKey=WWUZIQQURGPMPG-MCXRAWCPSA-N
SMILES:C(=C/CCCCCCCCCCCCC)\[C@@H]([C@@H](CO)N)O
Synonyms:- 4-Octadecene-1,3-diol, 2-amino-, (2R,3S,4E)-
- (2R,3S,4E)-2-Amino-4-octadecene-1,3-diol
- L-erythro-C18-Sphingosine
- 4-Octadecene-1,3-diol, 2-amino-, [S-[R*,S*-(E)]]-
- L-erythro-Sphingosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-Erythro-Sphingosine
CAS:L-erythro-Sphingosine is an L-isomer of sphingosine.Formula:C18H37NO2Color and Shape:SolidMolecular weight:299.49
