CAS 60373-76-4
:Pyridinium, 4-(2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-, chloride (1:1)
Description:
Pyridinium, 4-(2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-, chloride (1:1), with CAS number 60373-76-4, is a synthetic organic compound characterized by its complex structure, which includes a pyridinium moiety and a benzimidazole derivative. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in polar solvents and potential antimicrobial activity. The presence of the fluorophenyl group may enhance its lipophilicity and biological activity. The benzimidazole component is known for its diverse pharmacological properties, including anti-inflammatory and anticancer effects. As a chloride salt, it is likely to be stable under standard conditions but may require careful handling due to its potential reactivity and biological effects. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in drug development, where it may serve as a lead compound for further modifications aimed at enhancing efficacy and reducing toxicity.
Formula:C22H19FN3O2·Cl
InChI:InChI=1S/C22H18FN3O2.ClH/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28;/h1-2,4-5,7-12,14-15H,3,6,13H2;1H
InChI key:InChIKey=QNTOZKXLEFUDBT-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(N1)=CC=CC2)C=3C=C[N+](CCCC(=O)C4=CC=C(F)C=C4)=CC3.[Cl-]
Synonyms:- Pyridinium, 4-(2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-, chloride (1:1)
- Pyridinium, 4-(2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
