CymitQuimica logo

CAS 60374-42-7

:

6-Hydroxybentazon

Description:
6-Hydroxybentazon is a chemical compound that belongs to the class of herbicides, specifically used for controlling weeds in various agricultural settings. It is characterized by its hydroxyl group (-OH) attached to a benzene ring, which contributes to its reactivity and biological activity. The compound is typically a white to off-white solid and is soluble in organic solvents, but its solubility in water is limited. Its mode of action involves inhibiting specific biochemical pathways in plants, leading to their growth suppression. The compound is known for its selective herbicidal properties, making it effective against certain weed species while minimizing damage to crops. Safety and environmental impact assessments are crucial for its use, as with any chemical pesticide, to ensure it does not adversely affect non-target organisms or ecosystems. Proper handling and application according to regulatory guidelines are essential to mitigate potential risks associated with its use.
Formula:C10H12N2O4S
InChI:InChI=1S/C10H12N2O4S/c1-6(2)12-10(14)8-5-7(13)3-4-9(8)11-17(12,15)16/h3-6,11,13H,1-2H3
InChI key:InChIKey=PVKWIOBXPPFARA-UHFFFAOYSA-N
SMILES:O=C1C=2C(NS(=O)(=O)N1C(C)C)=CC=C(O)C2
Synonyms:
  • 1H-2,1,3-benzothiadiazin-4(3H)-one, 6-hydroxy-3-(1-methylethyl)-, 2,2-dioxide
  • 6-Hydroxy-3-isopropyl-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide
  • 6-Hydroxybentazon
  • 6-Hydroxybentazone
Found 6 products.