CAS 60376-97-8

N-(4-bromobenzyl)propan-2-amine

Description:

N-(4-bromobenzyl)propan-2-amine, with the CAS number 60376-97-8, is an organic compound characterized by its amine functional group and a bromobenzyl substituent. This compound features a propan-2-amine backbone, which indicates the presence of a secondary amine, where the nitrogen atom is bonded to two carbon atoms. The 4-bromobenzyl group introduces a bromine atom at the para position of the benzyl ring, enhancing the compound's reactivity and potentially influencing its biological activity. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and varying solubility in water, depending on the specific functional groups present. The presence of the bromine atom can also impart unique electronic properties, affecting the compound's interaction with biological systems. N-(4-bromobenzyl)propan-2-amine may be of interest in medicinal chemistry and pharmacology, particularly in the development of pharmaceuticals or as a research chemical. However, safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds.

Formula: C₁₀H₁₄BrN

InChI: InChI=1/C10H14BrN/c1-8(2)12-7-9-3-5-10(11)6-4-9/h3-6,8,12H,7H2,1-2H3

SMILES: CC(C)NCc1ccc(cc1)Br

Synonyms:

• [(4-bromophenyl)methyl](propan-2-yl)amineN-(4-Bromophenylmethyl)isopropylamine

(4-bromobenzyl)isopropylamine

CAS: 60376-97-8

Formula: C₁₀H₁₄BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 228.1289

Ref: IN-DA00EC2A

(4-bromobenzyl)isopropylamine

CAS: 60376-97-8

Formula: C₁₀H₁₄BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 228.133

Ref: 10-F309943

N-(4-Bromophenylmethyl)isopropylamine

CAS: 60376-97-8

Isopropylamine is an organic compound that is used as a solvent, a chemical intermediate and a base. It can be used to synthesize other compounds such as N-(4-bromophenylmethyl)isopropylamine. This compound has been shown to undergo transformation when in contact with chloroform or amines.

Formula: C₁₀H₁₄BrN

Purity: Min. 95%

Molecular weight: 228.13 g/mol

Ref: 3D-KCA37697