CAS 6038-23-9
:(16E)-3-hydroxy-16-(hydroxyimino)estra-1,3,5(10)-trien-17-one
Description:
(16E)-3-hydroxy-16-(hydroxyimino)estra-1,3,5(10)-trien-17-one, with the CAS number 6038-23-9, is a synthetic steroid compound that belongs to the class of estrogens. This compound features a hydroxyl group and a hydroxyimino group, which contribute to its biological activity and potential interactions with estrogen receptors. The presence of the triene structure indicates that it has multiple double bonds, which can influence its stability and reactivity. The configuration at the 16 position, denoted by the "E" designation, suggests a specific geometric arrangement that may affect its pharmacological properties. This compound is of interest in medicinal chemistry and pharmacology, particularly in the study of hormone-related therapies and the development of selective estrogen receptor modulators (SERMs). Its unique structural features may also provide insights into the mechanisms of action of steroid hormones and their analogs in biological systems. As with many steroid derivatives, it is essential to consider its solubility, stability, and potential biological effects when evaluating its applications in research or therapeutic contexts.
Formula:C18H21NO3
InChI:InChI=1/C18H21NO3/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19-22)17(18)21/h3,5,8,13-15,20,22H,2,4,6-7,9H2,1H3/b19-16+/t13-,14-,15+,18+/m1/s1
Synonyms:- 3-Hydroxyestra-1,3,5(10)-triene-16,17-dione 16-oxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Estrone 16-oxime
CAS:<p>Estrone 16-oxime is a medicinal compound that has shown promise as an anticancer agent. It is an analog of estrone, a hormone found in both men and women, and has been studied extensively for its ability to inhibit protein kinases involved in cancer cell growth and survival. Estrone 16-oxime has been shown to induce apoptosis (programmed cell death) in Chinese hamster ovary cells and human tumor cells. It also exhibits inhibitory effects against various kinases, making it a potential candidate for the development of novel kinase inhibitors for cancer therapy. This compound can be isolated from urine or synthesized chemically, making it readily available for research purposes.</p>Formula:C18H21NO3Purity:Min. 95%Molecular weight:299.4 g/mol
