CAS 60390-27-4
:2,6-dichlorodibenzo[b,d]furan
Description:
2,6-Dichlorodibenzo[b,d]furan is a polycyclic aromatic compound characterized by its fused benzene and furan rings, with chlorine substituents at the 2 and 6 positions of the dibenzofuran structure. This compound is typically a solid at room temperature and exhibits a complex aromatic structure, contributing to its stability and potential persistence in the environment. It is relatively hydrophobic, which influences its solubility in organic solvents rather than in water. The presence of chlorine atoms enhances its chemical stability but may also raise concerns regarding its environmental impact and toxicity. 2,6-Dichlorodibenzo[b,d]furan is of interest in various fields, including environmental chemistry and toxicology, due to its potential formation as a byproduct in combustion processes and its implications for human health and ecological systems. As with many chlorinated compounds, it may exhibit bioaccumulation potential and could pose risks to aquatic and terrestrial organisms. Proper handling and disposal are essential to mitigate any adverse effects associated with its use or release into the environment.
Formula:C12H6Cl2O
InChI:InChI=1/C12H6Cl2O/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h1-6H
SMILES:c1cc2c3cc(ccc3oc2c(c1)Cl)Cl
Synonyms:- 2,6-Dichlorodibenzofuran
- Dibenzofuran, 2,6-dichloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.