CAS 603951-43-5

1-(2,4-difluorophenyl)ethanamine

Description:

1-(2,4-Difluorophenyl)ethanamine, identified by its CAS number 603951-43-5, is an organic compound characterized by the presence of an ethanamine functional group attached to a difluorinated phenyl ring. This compound features two fluorine atoms positioned at the 2 and 4 positions of the phenyl ring, which can significantly influence its chemical properties, including its reactivity and polarity. The presence of the amino group (-NH2) makes it a primary amine, which can participate in various chemical reactions, such as nucleophilic substitutions and formation of amides. The difluorophenyl moiety may enhance the compound's lipophilicity and potentially its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between the difluorophenyl group and the ethanamine moiety.

Formula: C₈H₉F₂N

InChI: InChI=1/C8H9F2N/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5H,11H2,1H3

SMILES: CC(c1ccc(cc1F)F)N

Synonyms:

• 2,4-Difluoro-alpha-methyl-benzenmethanamine
• 1-(2',4'-Difluorophenyl)Ethylamine

1-(2',4'-DIFLUOROPHENYL)ETHYLAMINE

CAS: 603951-43-5

Formula: C₈H₉F₂N

Purity: 97%

Color and Shape: Liquid

Molecular weight: 157.1606

Ref: IN-DA00ECIY

1-(2,4-Difluorophenyl)ethanamine

CAS: 603951-43-5

1-(2,4-Difluorophenyl)ethanamine

Purity: 95%

Molecular weight: 157.16g/mol

Ref: 54-PC530059

1-(2’,4’-Difluorophenyl)ethylamine

Controlled Product

CAS: 603951-43-5

Applications A potent inhibitor for treatment of neurodegenerative diseases.

Formula: C₈H₉F₂N

Color and Shape: Neat

Molecular weight: 157.16

Ref: TR-D445865

1-(2,4-Difluorophenyl)ethylamine

CAS: 603951-43-5

Formula: C₈H₉F₂N

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 157.164

Ref: 10-F080255