CAS 60397-89-9

5'-O-{[4-(fluorosulfonyl)phenoxy](hydroxy)phosphoryl}adenosine

Description:

5'-O-{[4-(fluorosulfonyl)phenoxy](hydroxy)phosphoryl}adenosine is a chemical compound that belongs to the class of nucleotides, specifically a modified form of adenosine. This substance features a phosphoryl group linked to the 5' position of the adenosine molecule, which is further substituted with a phenoxy group that contains a fluorosulfonyl moiety. The presence of the fluorosulfonyl group imparts unique reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The hydroxy group enhances the compound's solubility and reactivity, making it suitable for various biochemical applications. Its structure suggests potential interactions with biological macromolecules, such as enzymes and receptors, which could be leveraged in drug design. The compound's CAS number, 60397-89-9, allows for its identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the intricate design of modified nucleotides for specialized functions in biochemical research and therapeutic applications.

Formula: C₁₆H₁₇FN₅O₉PS

InChI: InChI=1/C16H17FN5O9PS/c17-33(27,28)9-3-1-8(2-4-9)31-32(25,26)29-5-10-12(23)13(24)16(30-10)22-7-21-11-14(18)19-6-20-15(11)22/h1-4,6-7,10,12-13,16,23-24H,5H2,(H,25,26)(H2,18,19,20)/t10-,12-,13-,16-/m1/s1

SMILES: c1cc(ccc1OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)S(=O)(=O)F

Adenosine-5'-(4-fluorosulfonylphenylphosphate)

CAS: 60397-89-9

Adenosine-5'-(4-fluorosulfonylphenylphosphate) is a novel nucleoside compound. It is an analogue of adenosine, which has been shown to be effective against cancer and to inhibit viral replication. Adenosine-5'-(4-fluorosulfonylphenylphosphate) inhibits the synthesis of DNA and RNA by binding to the ribonucleotide reductase enzyme and inhibiting the conversion of ribonucleotides into deoxyribonucleotides. This leads to cell death.

Formula: C₁₆H₁₇FN₅O₉PS

Purity: Min. 95%

Molecular weight: 505.37 g/mol

Ref: 3D-NA89737