CAS 604-87-5: 2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthalene-1,4-diyl diacetate
Description:The chemical substance known as 2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthalene-1,4-diyl diacetate, with the CAS number 604-87-5, is a complex organic compound characterized by its naphthalene backbone and multiple substituents. This compound features a diacetate functional group, which contributes to its reactivity and solubility properties. The presence of the long aliphatic chain, specifically the tetramethylhexadecene moiety, suggests that it may exhibit hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The stereochemistry indicated by the (2E,7R,11R) configuration implies specific spatial arrangements that can influence the compound's biological activity and interactions. Additionally, the methyl groups contribute to steric hindrance, potentially affecting its reactivity and interaction with biological systems. Overall, this compound may have applications in fields such as organic synthesis, materials science, or as a fragrance component, depending on its specific properties and behavior in various environments.
Formula:C35H52O4
InChI:InChI=1/C35H52O4/c1-24(2)14-11-15-25(3)16-12-17-26(4)18-13-19-27(5)22-23-31-28(6)34(38-29(7)36)32-20-9-10-21-33(32)35(31)39-30(8)37/h9-10,20-22,24-26H,11-19,23H2,1-8H3/b27-22+/t25-,26-/m1/s1

Dihydro Vitamin K1 Diacetate (Di-O-Acetyl-Dihydrophyllochinon)
Ref: 4Z-V-1416
5mg | 944.00 € | ||
10mg | 1,563.00 € | ||
25mg | 2,864.00 € | ||
50mg | 4,687.00 € | ||
100mg | 7,746.00 € |

Dihydrovitamin K1 Diacetate
Controlled ProductRef: TR-D448498
5mg | 201.00 € | ||
25mg | 756.00 € | ||
100mg | 1,957.00 € |

Dihydrovitamin K1 diacetate
Ref: 3D-AAA60487
25mg | 911.00 € | ||
50mg | 1,195.00 € | ||
100mg | 1,912.00 € |