CAS 604-99-9

Normacusine B

Description:

Normacusine B is a chemical compound classified as an alkaloid, which is a type of naturally occurring organic nitrogen-containing compound. It is derived from various plant sources and is known for its potential biological activities. The molecular structure of Normacusine B features a complex arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique properties. This compound has garnered interest in pharmacology due to its potential therapeutic effects, including anti-inflammatory and analgesic properties. Normacusine B may also exhibit interactions with various biological targets, making it a subject of research in medicinal chemistry. Its CAS number, 604-99-9, serves as a unique identifier for this substance in chemical databases, facilitating its study and application in various scientific fields. As with many alkaloids, the safety and efficacy of Normacusine B in medicinal use require thorough investigation, including toxicity assessments and clinical trials, to fully understand its potential benefits and risks.

Formula: C₁₉H₂₂N₂O

InChI: InChI=1S/C19H22N2O/c1-2-11-9-21-17-8-14-12-5-3-4-6-16(12)20-19(14)18(21)7-13(11)15(17)10-22/h2-6,13,15,17-18,20,22H,7-10H2,1H3/b11-2-/t13-,15+,17-,18-/m0/s1

InChI key: InChIKey=VXTDUGOBAOLMED-VICVVEARSA-N

SMILES: C(O)[C@H]1[C@]2([N@@]3[C@](C4=C(C=5C(N4)=CC=CC5)C2)(C[C@]1(/C(=C\C)/C3)[H])[H])[H]

Synonyms:

• Sarpagan-17-ol
• Tombozine
• Normacusine B
• Tombozin
• Vellosiminol

(+)-Normacusine B

CAS: 604-99-9

Formula: C₁₉H₂₂N₂O

Purity: 98%

Molecular weight: 294.3908

Ref: IN-DA00EGWB

Tombozine

CAS: 604-99-9

Tombozine is a natural product from Rauvolfia yunnanensis.

Formula: C₁₉H₂₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.398

Ref: TM-TN6012

Tombozine

CAS: 604-99-9

Formula: C₁₉H₂₂N₂O

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 294.398

Ref: BP-SBP00899

Tombozine

CAS: 604-99-9

Please enquire for more information about Tombozine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₉H₂₂N₂O

Purity: Min. 95%

Molecular weight: 294.4 g/mol

Ref: 3D-AAA60499