CAS 604003-26-1

ethyl 4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate

Description:

Ethyl 4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazolo and diazepine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the ethyl ester group suggests it may have moderate lipophilicity, influencing its interaction with biological membranes. The 4-oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. Additionally, the tetrahydro configuration implies that the compound is saturated, which may affect its stability and reactivity. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. Overall, ethyl 4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate represents a unique structure that may offer insights into new therapeutic agents.

Formula: C₁₀H₁₃N₃O₃

InChI: InChI=1/C10H13N3O3/c1-2-16-10(15)7-6-8-9(14)11-4-3-5-13(8)12-7/h6H,2-5H2,1H3,(H,11,14)

SMILES: CCOC(=O)c1cc2C(=O)NCCCn2n1

Synonyms:

• 604003-26-1

4-Oxo-5,6,7,8-tetrahydro-4H-1,5,8a-triaza-azulene-2-carboxylic acid ethyl ester

CAS: 604003-26-1

Formula: C₁₀H₁₃N₃O₃

Purity: 95%

Molecular weight: 223.2285

Ref: IN-DA00EK0C

ETHYL 4-OXO-5,6,7,8-TETRAHYDRO-4H-PYRAZOLO[1,5-A][1,4]DIAZEPINE-2-CARBOXYLATE

CAS: 604003-26-1

Formula: C₁₀H₁₃N₃O₃

Purity: 95.0%

Molecular weight: 223.232

Ref: 10-F501820