CAS 60402-29-1

3-(4-chlorophenyl)-3-hydroxy-1-(2-hydroxy-5-methylphenyl)prop-2-en-1-one

Description:

3-(4-chlorophenyl)-3-hydroxy-1-(2-hydroxy-5-methylphenyl)prop-2-en-1-one, also known by its CAS number 60402-29-1, is an organic compound characterized by its complex structure featuring multiple functional groups. It contains a prop-2-en-1-one backbone, which is indicative of its potential reactivity and ability to participate in various chemical reactions, such as Michael additions or condensation reactions. The presence of hydroxyl groups (-OH) suggests that the compound may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The chlorophenyl and methyl-substituted phenyl groups contribute to its aromatic character, which can affect its electronic properties and stability. This compound may also exhibit biological activity, making it of interest in pharmaceutical and medicinal chemistry. Its structural features suggest potential applications in areas such as dye synthesis, agrochemicals, or as intermediates in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₆H₁₃ClO₃

InChI: InChI=1/C16H13ClO3/c1-10-2-7-14(18)13(8-10)16(20)9-15(19)11-3-5-12(17)6-4-11/h2-9,18-19H,1H3

SMILES: Cc1ccc(c(c1)C(=O)C=C(c1ccc(cc1)Cl)O)O

1-(2-Hydroxy-5-methylphenyl)-3-(4-chlorophenyl)-1,3-propanedione

CAS: 60402-29-1

Formula: C₁₆H₁₃ClO₃

Molecular weight: 288.73

Ref: 10-F012194