CAS 60404-18-4
:3-Bromo-2,5-dichlorothiophene
Description:
3-Bromo-2,5-dichlorothiophene is a heterocyclic organic compound characterized by a five-membered ring containing sulfur and halogen substituents. Its molecular structure features a thiophene ring with two chlorine atoms and one bromine atom attached at specific positions, contributing to its unique reactivity and properties. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic characteristics, which can influence its stability and reactivity in various chemical reactions. The presence of halogen atoms enhances its electrophilic nature, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3-Bromo-2,5-dichlorothiophene may exhibit interesting electronic properties, making it a candidate for applications in materials science, such as organic semiconductors. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, this compound serves as a valuable building block in various chemical syntheses and research applications.
Formula:C4HBrCl2S
InChI:InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H
SMILES:c1c(c(Cl)sc1Cl)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-2,5-dichlorothiophene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4HBrCl2SPurity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:231.923-Bromo-2,5-dichlorothiophene
CAS:Versatile small molecule scaffold
Formula:C4HBrCl2SPurity:Min. 95%Molecular weight:231.93 g/mol




