CAS 60414-06-4
:Therafectin
Description:
Therafectin, identified by the CAS number 60414-06-4, is a chemical compound that is primarily known for its use in pharmaceutical applications. It is often associated with properties that may provide therapeutic benefits, particularly in the context of treating various health conditions. The substance typically exhibits characteristics such as solubility in specific solvents, stability under certain conditions, and a defined molecular structure that contributes to its biological activity. As with many pharmaceutical compounds, its efficacy and safety profile would be determined through rigorous testing and clinical trials. Additionally, the compound may interact with biological systems in a manner that necessitates careful consideration of dosage and administration routes. While specific details about its chemical structure and mechanism of action may vary, the general characteristics of such compounds include their potential for targeted therapeutic effects and the importance of understanding their pharmacokinetics and pharmacodynamics in clinical settings.
Formula:C14H28ClNO6
InChI:InChI=1/C14H27NO6.ClH/c1-14(2)20-12-11(18-7-5-6-15(3)4)10(9(17)8-16)19-13(12)21-14;/h9-13,16-17H,5-8H2,1-4H3;1H/t9?,10-,11+,12-,13-;/m1./s1
Synonyms:- Amiprilose hydrochloride
- 3-O-[3-(Dimethylamino)propyl]-1,2-O-(1-methylethylidene)-alpha-D-glucofuranose hydrochloride
- 1-[(3aR,5R,6S,6aR)-6-(3-dimethylaminopropoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[4,5-d][1,3]dioxol-5-yl]ethane-1,2-diol hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Amiprilose hydrochloride
CAS:Amiprilose hydrochloride is an Immunopotentiator.Formula:C14H28ClNO6Color and Shape:SolidMolecular weight:341.83Amiprilose hydrochloride
CAS:<p>Amiprilose hydrochloride is a nonsteroidal anti-inflammatory drug (NSAID) that inhibits the production of prostaglandins. It has been shown to have antimicrobial properties against skin cells and has been used as a topical treatment for wounds. Amiprilose may also be effective in treating inflammatory diseases, such as rheumatoid arthritis and ulcerative colitis, by inhibiting the production of IL-2 receptors. This drug is also used as a diagnostic tool in infectious diseases and has been found to be active against various bacteria, including Staphylococcus aureus and Escherichia coli; fungi including Candida albicans, Saccharomyces cerevisiae, and Aspergillus niger; protozoa such as Entamoeba histolytica; and viruses such as herpes simplex virus type 1. Amiprilose can inhibit inflammation by blocking the activity of leukotrienes. It is also</p>Formula:C14H27NO6·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:341.83 g/molAmiprilose Hydrochloride
CAS:Controlled ProductFormula:C14H27NO6•HClColor and Shape:NeatMolecular weight:341.83




