CAS 60414-59-7

6-phenylpyrimidine-2(1H)-thione

Description:

6-Phenylpyrimidine-2(1H)-thione is a heterocyclic compound characterized by a pyrimidine ring substituted with a phenyl group and a thione functional group. The molecular structure features a six-membered aromatic ring containing nitrogen atoms, which contributes to its basicity and potential reactivity. The thione group, characterized by a sulfur atom double-bonded to a carbon atom, imparts unique chemical properties, including the ability to participate in various nucleophilic and electrophilic reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, 6-phenylpyrimidine-2(1H)-thione can serve as a precursor or intermediate in the synthesis of more complex organic molecules. Safety data should be reviewed before handling, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile building block in organic synthesis and may have applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₈N₂S

InChI: InChI=1/C10H8N2S/c13-10-11-7-6-9(12-10)8-4-2-1-3-5-8/h1-7H,(H,11,12,13)

SMILES: c1ccc(cc1)c1ccnc(n1)S

Synonyms:

• 2-Pyrimidinethiol, 4-Phenyl-
• 4-Phenylpyrimidine-2-thiol

2(1H)-Pyrimidinethione, 4-phenyl-

CAS: 60414-59-7

Formula: C₁₀H₈N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.2489

Ref: IN-DA00IAP4

4-Phenylpyrimidine-2-thiol

CAS: 60414-59-7

4-Phenylpyrimidine-2-thiol

Purity: ≥95%

Color and Shape: Yellow Powder

Molecular weight: 188.25g/mol

Ref: 54-OR7651

4-Phenylpyrimidine-2-thiol

CAS: 60414-59-7

Formula: C₁₀H₈N₂S

Purity: 98%

Color and Shape: Solid, Yellow powder

Molecular weight: 188.25

Ref: 10-F463864

4-Phenylpyrimidine-2-thiol

CAS: 60414-59-7

4-Phenylpyrimidine-2-thiol is a chemical compound that belongs to the group of elemental compounds. It has a density of 1.5 g/mL, a melting point of > 200 °C, and a boiling point of > 300 °C. 4-Phenylpyrimidine-2-thiol has been shown to exist as chains with assembled chains in the crystalline state. The crystals are composed of two molecules stacked on top of each other in an antiparallel orientation. The crystal structure was solved through x-ray crystallography and single-crystal x-ray diffraction. 4-Phenylpyrimidine-2-thiol is dimeric in solution and polymerizes in the solid state to form polymers with chains consisting of four phenylpyrimidine units. This compound has an elemental analysis consisting mainly of carbon and hydrogen, with small amounts of sulfur and nitrogen present.

Formula: C₁₀H₈N₂S

Purity: Min. 95%

Molecular weight: 188.25 g/mol

Ref: 3D-NP57408