CAS 60419-23-0

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine

Description:

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine, with the CAS number 60419-23-0, is a chiral organic compound characterized by its dual pyrrolidine rings, which contribute to its unique structural and stereochemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits basic properties due to the presence of nitrogen atoms in the pyrrolidine rings, allowing it to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The stereochemistry of the compound is significant, as the (R)-(-) configuration can influence its biological activity and interactions with other molecules, making it of interest in medicinal chemistry and drug development. Additionally, it may exhibit solubility in polar solvents, which is common for amine-containing compounds. Its potential applications could range from pharmaceuticals to agrochemicals, depending on its specific interactions and reactivity in biological systems.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H18N2/c1-2-7-11(6-1)8-9-4-3-5-10-9/h9-10H,1-8H2/p+2/t9-/m1/s1

Synonyms:

• 1-[(2R)-Pyrrolidin-2-ylmethyl]pyrrolidine
• pyrrolidine, 1-[(2R)-2-pyrrolidinylmethyl]-
• Pyrrolidine, 2.beta.-[(1-pyrrolidyl)methyl]-
• 1-[(2R)-pyrrolidinium-2-ylmethyl]pyrrolidinium

(R)-1-(Pyrrolidin-2-ylmethyl)pyrrolidine

CAS: 60419-23-0

Formula: C₉H₁₈N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 154.2526

Ref: IN-DA003C73

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine

CAS: 60419-23-0

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine

Purity: 95%

Molecular weight: 154.25g/mol

Ref: 54-OR913029

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine

CAS: 60419-23-0

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine is a soluble, colorless liquid that has been shown to have respiratory effects. Studies have demonstrated that it can cause respiratory depression in animals by depleting the oxygen in the lungs. It is also soluble in toluene and ether, making it useful for organic synthesis.

Formula: C₉H₁₈N₂

Purity: Min. 95%

Color and Shape: Colorless Slightly Yellow Clear Liquid

Molecular weight: 154.25 g/mol

Ref: 3D-FP59900

(R)-(-)-1-(2-Pyrrolidinylmethyl)pyrrolidine

CAS: 60419-23-0

Formula: C₉H₁₈N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 154.257

Ref: 10-F076647