CymitQuimica logo

CAS 6042-36-0

:

N-(2-bromo-4,5-dimethoxyphenyl)-N-[2-(diethylamino)ethyl]-N',N'-diethylethane-1,2-diamine

Description:
N-(2-bromo-4,5-dimethoxyphenyl)-N-[2-(diethylamino)ethyl]-N',N'-diethylethane-1,2-diamine, with the CAS number 6042-36-0, is a chemical compound that features a complex structure characterized by multiple functional groups. It contains a bromo-substituted aromatic ring, which contributes to its reactivity and potential biological activity. The presence of methoxy groups enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The diethylamino group suggests that the compound may exhibit basic properties, which could affect its pharmacological profile. Additionally, the presence of the ethylene diamine moiety indicates potential for chelation or interaction with metal ions. This compound may be of interest in medicinal chemistry due to its structural features that could lead to various biological activities, including potential use as a pharmaceutical agent. However, specific applications and safety profiles would require further investigation through empirical studies and toxicological assessments.
Formula:C20H36BrN3O2
InChI:InChI=1/C20H36BrN3O2/c1-7-22(8-2)11-13-24(14-12-23(9-3)10-4)18-16-20(26-6)19(25-5)15-17(18)21/h15-16H,7-14H2,1-6H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • WR-27653

    CAS:
    WR-27653 (RC-12), a derivative of Catechol, demonstrates significant activity against hypnozoites in the Plasmodium cynomolgi-Rhesus monkey (Macaca mulatta) model, which is considered the gold standard. Additionally, WR-27653 exhibits antimalarial properties.
    Formula:C20H36BrN3O2
    Color and Shape:Solid
    Molecular weight:430.423

    Ref: TM-T206084

    10mg
    To inquire
    50mg
    To inquire