CAS 60433-90-1
:4-(dimethyl-13C2-amino)antipyrine
Description:
4-(Dimethyl-13C2-amino)antipyrine, with the CAS number 60433-90-1, is a chemical compound that belongs to the class of antipyrines, which are known for their analgesic and antipyretic properties. This substance features a dimethylamino group at the 4-position of the antipyrine structure, which contributes to its pharmacological activity. The incorporation of the stable isotope carbon-13 (13C2) in the dimethylamino group allows for isotopic labeling, making it useful in various biochemical and pharmacokinetic studies. The compound is typically characterized by its molecular formula, which reflects the presence of carbon, hydrogen, nitrogen, and the isotopic carbon. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. As with many antipyrines, it may exhibit interactions with biological systems, influencing its metabolism and efficacy. Safety and handling precautions are essential when working with this compound, as it may have specific toxicity profiles or regulatory considerations in research and pharmaceutical applications.
Formula:C1113C2H17N3O
InChI:InChI=1/C13H17N3O/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11/h5-9H,1-4H3/i2+1,3+1
Synonyms:- 4-{bis[(13C)methyl]amino}-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Aminopyrine (N,N-Dimethyl-13C2)
CAS:Controlled ProductApplications Aminopyrine (N,N-Dimethyl-13c2, 99%) Microbiological/Pyrogen Tested (cas# 60433-90-1) is a useful research chemical.
Formula:C1113C2H17N3OColor and Shape:NeatMolecular weight:233.28
