CymitQuimica logo

CAS 60439-45-4

:

4-(morpholin-4-yl)butan-2-yl 3,4,5-trimethoxybenzoate

Description:
4-(Morpholin-4-yl)butan-2-yl 3,4,5-trimethoxybenzoate, with the CAS number 60439-45-4, is a chemical compound characterized by its complex structure, which includes a morpholine ring and a benzoate moiety. This substance typically exhibits properties associated with both its morpholine and aromatic components, such as moderate solubility in organic solvents and potential bioactivity due to the presence of the morpholine group, which is often involved in pharmacological applications. The trimethoxy substitution on the benzoate ring enhances its lipophilicity and may influence its interaction with biological targets. As a result, this compound may possess interesting pharmacokinetic properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in the development of pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C18H27NO6
InChI:InChI=1/C18H27NO6/c1-13(5-6-19-7-9-24-10-8-19)25-18(20)14-11-15(21-2)17(23-4)16(12-14)22-3/h11-13H,5-10H2,1-4H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.