CAS 6044-73-1
:11-(3-fluorophenyl)-3,3-dimethyl-10-(phenylacetyl)-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
Description:
The chemical substance known as 11-(3-fluorophenyl)-3,3-dimethyl-10-(phenylacetyl)-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one, with the CAS number 6044-73-1, is a member of the dibenzo diazepine class of compounds. This compound features a complex structure characterized by a fused bicyclic system that includes a diazepine ring, which contributes to its potential pharmacological properties. The presence of a fluorophenyl group and a phenylacetyl moiety suggests that it may exhibit significant interactions with biological targets, potentially influencing its activity as a pharmaceutical agent. The dimethyl substitution at the 3-position of the diazepine ring may enhance lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the hexahydro configuration indicates that the compound is saturated, which may influence its stability and reactivity. Overall, this compound's unique structural features may contribute to its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation.
Formula:C29H27FN2O2
InChI:InChI=1/C29H27FN2O2/c1-29(2)17-23-27(25(33)18-29)28(20-11-8-12-21(30)16-20)32(24-14-7-6-13-22(24)31-23)26(34)15-19-9-4-3-5-10-19/h3-14,16,28,31H,15,17-18H2,1-2H3
Synonyms:- 11-(3-Fluorophenyl)-3,3-dimethyl-10-(phenylacetyl)-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
- 1H-Dibenzo[b,e][1,4]diazepin-1-one, 11-(3-fluorophenyl)-2,3,4,5,10,11-hexahydro-3,3-dimethyl-10-(2-phenylacetyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-1,4-Dibromo-2,3-Dimethylbut-2-Ene
CAS:Formula:C6H10Br2Color and Shape:Pale Yellow SolidMolecular weight:241.95
