CAS 60442-45-7

ethyl 2-[(3-chloropropanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate

Description:

Ethyl 2-[(3-chloropropanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate, with the CAS number 60442-45-7, is a chemical compound characterized by its complex structure that includes a benzothiophene core, an ethyl ester group, and an amide linkage with a chloropropanoyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility, reactivity, and biological activity. The presence of the chloropropanoyl group suggests potential for electrophilic reactivity, while the benzothiophene moiety may contribute to its pharmacological properties. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values. Overall, this compound's unique structural features make it a subject of interest in various chemical and biological research fields.

Formula: C₁₄H₁₈ClNO₃S

InChI: InChI=1/C14H18ClNO3S/c1-2-19-14(18)12-9-5-3-4-6-10(9)20-13(12)16-11(17)7-8-15/h2-8H2,1H3,(H,16,17)

SMILES: CCOC(=O)c1c2CCCCc2sc1N=C(CCCl)O

Synonyms:

• Benzo[b]thiophene-3-carboxylic acid, 2-[(3-chloro-1-oxopropyl)amino]-4,5,6,7-tetrahydro-, ethyl ester

ethyl 2-(3-chloropropanamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate

CAS: 60442-45-7

Formula: C₁₄H₁₈ClNO₃S

Purity: 95.0%

Molecular weight: 315.81

Ref: 10-F494488