CAS 60450-21-7
:1,5-dihydroxy-6-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside
Description:
1,5-Dihydroxy-6-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside is a complex organic compound characterized by its anthraquinone structure, which includes multiple hydroxyl and keto groups contributing to its reactivity and potential biological activity. The presence of sugar moieties, specifically a glucopyranoside and a deoxy-mannopyranosyl unit, suggests that this compound may exhibit glycosidic properties, influencing its solubility and interaction with biological systems. The hydroxyl groups can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may also possess antioxidant properties due to the presence of the anthraquinone core, which is known for its ability to scavenge free radicals. Its structural complexity indicates potential applications in pharmaceuticals or as a natural product in medicinal chemistry. However, specific biological activities, stability, and reactivity would require further investigation through empirical studies.
Formula:C27H30O14
InChI:InChI=1/C27H30O14/c1-8-3-4-10-14(16(8)28)18(30)11-5-6-12(20(32)15(11)19(10)31)40-27-25(37)23(35)21(33)13(41-27)7-38-26-24(36)22(34)17(29)9(2)39-26/h3-6,9,13,17,21-29,32-37H,7H2,1-2H3/t9-,13+,17-,21+,22+,23-,24+,25+,26+,27+/m0/s1
Synonyms:- 60450-21-7
- b-Morindin
- Morindin
- Morindone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Morindin
CAS:Natural glycosideFormula:C26H28O14Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:564.5Morindin
CAS:<p>Morindin is a bioactive compound, classified as an anthraquinone glycoside. It is primarily sourced from the fruit and leaves of the Morinda citrifolia plant, commonly known as noni. This compound is known for its multifaceted mode of action, predominantly through its antioxidant, anti-inflammatory, and antimicrobial activities. It interacts at the cellular level by modulating oxidative stress pathways and inhibiting inflammatory mediators, thereby offering protective effects in biological systems.</p>Formula:C26H28O14Purity:Min. 95%Molecular weight:564.5 g/mol

