CymitQuimica logo

CAS 60451-92-5

:

17-iodoheptadecanoic acid

Description:
17-Iodoheptadecanoic acid is a long-chain fatty acid characterized by the presence of a 17-carbon chain with an iodine atom substituted at the 17th position. This compound belongs to the class of fatty acids, which are carboxylic acids with long aliphatic chains. The iodine substitution can significantly influence the chemical properties, such as reactivity and solubility. Typically, fatty acids like this one are hydrophobic due to their long hydrocarbon chains, but the presence of the iodine atom can introduce unique characteristics, potentially enhancing its reactivity in certain chemical reactions. This compound may be used in various applications, including biochemical research and as a potential precursor in organic synthesis. Its molecular structure allows for interactions with biological systems, making it of interest in studies related to lipid metabolism and membrane dynamics. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity and environmental impact.
Formula:C17H33IO2
InChI:InChI=1/C17H33IO2/c18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17(19)20/h1-16H2,(H,19,20)
SMILES:C(CCCCCCCCI)CCCCCCCC(=O)O
Synonyms:
  • Heptadecanoic acid, 17-iodo-
  • 17-Iodoheptadecanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.