CAS 6046-42-0
:4-Quinolinesulfonic acid
Description:
4-Quinolinesulfonic acid, with the CAS number 6046-42-0, is an organic compound characterized by its quinoline structure, which features a sulfonic acid group (-SO3H) at the 4-position. This compound is typically a white to pale yellow crystalline solid that is soluble in water and polar organic solvents. It exhibits acidic properties due to the presence of the sulfonic acid group, making it useful in various chemical reactions and applications. 4-Quinolinesulfonic acid is often employed as a reagent in organic synthesis, particularly in the preparation of dyes, pharmaceuticals, and other biologically active compounds. Additionally, it can act as a catalyst or a pH indicator in certain chemical processes. The compound's unique structure allows for various interactions, including hydrogen bonding and coordination with metal ions, which can enhance its utility in coordination chemistry and materials science. Safety precautions should be observed when handling this compound, as with many sulfonic acids, due to its corrosive nature.
Formula:C9H7NO3S
InChI:InChI=1S/C9H7NO3S/c11-14(12,13)9-5-6-10-8-4-2-1-3-7(8)9/h1-6H,(H,11,12,13)
InChI key:InChIKey=UJRYDUDEJGXDNA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C(N=CC1)C=CC=C2
Synonyms:- 4-Quinolinesulfonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Quinoline-4-sulfonic acid
CAS:Quinoline-4-sulfonic acid is a chemical compound that belongs to the class of quinoline derivatives. It has a linear range of activity and inhibits enzymes such as glutamicum, organisms, additives, metal ion, alkali metal, heterocycle, methyl groups and oxygenated. The optimum pH for this compound is 7. Quinoline-4-sulfonic acid is not very soluble in water but is soluble in an organic solvent such as acetone or ethanol. This molecule has been shown to be active against strains of Escherichia coli.
Formula:C9H7NO3SPurity:Min. 95%Molecular weight:209.22 g/mol
