CymitQuimica logo

CAS 60462-19-3

:

methyl 4-(hydroxymethyl)pentacyclo[4.2.0.0~2,5~.0~3,8~.0~4,7~]octane-1-carboxylate

Description:
Methyl 4-(hydroxymethyl)pentacyclo[4.2.0.0^2,5.0^3,8.0^4,7.]octane-1-carboxylate, with CAS number 60462-19-3, is a complex organic compound characterized by its unique polycyclic structure. This substance features a pentacyclic framework, which contributes to its rigidity and stability. The presence of a carboxylate group indicates that it can participate in various chemical reactions, including esterification and acid-base reactions. The hydroxymethyl group enhances its reactivity and solubility in polar solvents, making it useful in various chemical applications. Additionally, the methyl ester functionality suggests potential applications in organic synthesis and as a building block in the development of pharmaceuticals or agrochemicals. Its structural complexity may also impart interesting physical properties, such as melting and boiling points, which are influenced by the arrangement of its rings and functional groups. Overall, this compound exemplifies the intricate nature of organic chemistry, showcasing how structural variations can lead to diverse chemical behaviors and potential applications.
Formula:C11H12O3
InChI:InChI=1/C11H12O3/c1-14-9(13)11-6-3-7(11)5-8(11)4(6)10(3,5)2-12/h3-8,12H,2H2,1H3
InChI key:JYRRBVFDZGSZBE-UHFFFAOYSA-N
SMILES:COC(=O)C12C3C4C1C1C2C3C41CO
Synonyms:
  • methyl(2r,3R,4s,5S)-4-(hydroxymethyl)cubane-1-carboxylate
Found 4 products.