CAS 60463-12-9

5-hydroxy-2-nitrobenzyl alcohol

Description:

5-Hydroxy-2-nitrobenzyl alcohol, with the CAS number 60463-12-9, is an organic compound characterized by the presence of both hydroxyl (-OH) and nitro (-NO2) functional groups attached to a benzyl alcohol structure. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of dyes or other chemical compounds. Additionally, the presence of both functional groups may impart unique properties, such as altered acidity or reactivity compared to other benzyl alcohol derivatives. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₇H₇NO₄

InChI: InChI=1/C7H7NO4/c9-4-5-3-6(10)1-2-7(5)8(11)12/h1-3,9-10H,4H2

SMILES: c1cc(c(cc1O)CO)N(=O)=O

Synonyms:

• 3-(Hydroxymethyl)-4-Nitrophenol

5-Hydroxy-2-nitrobenzyl alcohol

CAS: 60463-12-9

Formula: C₇H₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.1348

Ref: IN-DA00EACJ

5-Hydroxy-2-Nitrobenzyl Alcohol

CAS: 60463-12-9

5-Hydroxy-2-Nitrobenzyl Alcohol

Purity: 98%

Molecular weight: 169.13g/mol

Ref: 54-OR1011882

(5-Hydroxy-2-nitrophenyl)methanol

CAS: 60463-12-9

Formula: C₇H₇NO₄

Purity: 95%

Color and Shape: Light yellow powder

Molecular weight: 169.136

Ref: 10-F225087

3-(Hydroxymethyl)-4-nitrophenol

Controlled Product

CAS: 60463-12-9

Applications 3-(Hydroxymethyl)-4-nitrophenol (cas# 60463-12-9) is a useful research chemical.

Formula: C₇H₇NO₄

Color and Shape: Neat

Molecular weight: 169.13

Ref: TR-H973090

5-Hydroxy-2-nitrobenzyl alcohol

CAS: 60463-12-9

5-Hydroxy-2-nitrobenzyl alcohol is a hydrogen bond donor that has been used to coat materials. This compound has been shown to induce a phase transition in the cervical cancer cells, leading to apoptosis. The binding experiments show that it binds to lectin, but not nucleophilic groups. 5-Hydroxy-2-nitrobenzyl alcohol also inhibits the uptake of glucose by cells and reduces the growth of tumor cells in vitro.

Formula: C₇H₇NO₄

Purity: Min. 95%

Molecular weight: 169.13 g/mol

Ref: 3D-KCA46312