CAS 60463-12-9
:5-hydroxy-2-nitrobenzyl alcohol
Description:
5-Hydroxy-2-nitrobenzyl alcohol, with the CAS number 60463-12-9, is an organic compound characterized by the presence of both hydroxyl (-OH) and nitro (-NO2) functional groups attached to a benzyl alcohol structure. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of dyes or other chemical compounds. Additionally, the presence of both functional groups may impart unique properties, such as altered acidity or reactivity compared to other benzyl alcohol derivatives. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C7H7NO4
InChI:InChI=1/C7H7NO4/c9-4-5-3-6(10)1-2-7(5)8(11)12/h1-3,9-10H,4H2
SMILES:c1cc(c(cc1O)CO)N(=O)=O
Synonyms:- 3-(Hydroxymethyl)-4-Nitrophenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Hydroxy-2-nitrobenzyl alcohol
CAS:Formula:C7H7NO4Purity:98%Color and Shape:SolidMolecular weight:169.13485-Hydroxy-2-Nitrobenzyl Alcohol
CAS:5-Hydroxy-2-Nitrobenzyl AlcoholPurity:98%Molecular weight:169.13g/mol(5-Hydroxy-2-nitrophenyl)methanol
CAS:Formula:C7H7NO4Purity:95%Color and Shape:Light yellow powderMolecular weight:169.1363-(Hydroxymethyl)-4-nitrophenol
CAS:Controlled ProductApplications 3-(Hydroxymethyl)-4-nitrophenol (cas# 60463-12-9) is a useful research chemical.
Formula:C7H7NO4Color and Shape:NeatMolecular weight:169.135-Hydroxy-2-nitrobenzyl alcohol
CAS:5-Hydroxy-2-nitrobenzyl alcohol is a hydrogen bond donor that has been used to coat materials. This compound has been shown to induce a phase transition in the cervical cancer cells, leading to apoptosis. The binding experiments show that it binds to lectin, but not nucleophilic groups. 5-Hydroxy-2-nitrobenzyl alcohol also inhibits the uptake of glucose by cells and reduces the growth of tumor cells in vitro.
Formula:C7H7NO4Purity:Min. 95%Molecular weight:169.13 g/mol





