CAS 60469-88-7

benzoic acid, 3,4-dibromo-, ethyl ester

Description:

Benzoic acid, 3,4-dibromo-, ethyl ester, with the CAS number 60469-88-7, is an organic compound characterized by its ester functional group derived from benzoic acid and ethyl alcohol. This compound features a benzene ring substituted with two bromine atoms at the 3 and 4 positions, which significantly influences its chemical properties and reactivity. The presence of bromine atoms enhances the compound's electrophilicity, making it more reactive in various chemical reactions. Typically, esters like this one exhibit moderate solubility in organic solvents and lower solubility in water due to their hydrophobic aromatic structure. The compound may be used in organic synthesis and as an intermediate in the production of other chemicals. Additionally, the bromine substituents can impart unique biological activities, making such compounds of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and potential hazards, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula: C₉H₈Br₂O₂

InChI: InChI=1/C9H8Br2O2/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3

SMILES: CCOC(=O)c1ccc(c(c1)Br)Br

3,4-DIBROMOBENZOIC ACID ETHYL ESTER

CAS: 60469-88-7

Formula: C₉H₈Br₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 307.9666

Ref: IN-DA00EAB9

Ethyl 3,4-dibromobenzoate

CAS: 60469-88-7

Formula: C₉H₈Br₂O₂

Purity: 95.0%

Molecular weight: 307.969

Ref: 10-F215304

3,4-Dibromobenzoic acid ethyl ester

CAS: 60469-88-7

3,4-Dibromobenzoic acid ethyl ester is a high quality reagent that can be used as an intermediate for the synthesis of complex compounds. It is also useful as a building block for the synthesis of speciality chemicals and research chemicals. 3,4-Dibromobenzoic acid ethyl ester can be used in reactions such as Friedel-Crafts reactions, reducing reactions, and condensations. This chemical is a versatile building block that can be used to construct organic molecules with diverse structures. 3,4-Dibromobenzoic acid ethyl ester is a fine chemical with CAS number 60469-88-7.

Formula: C₉H₈Br₂O₂

Purity: Min. 95%

Molecular weight: 307.97 g/mol

Ref: 3D-FD69946