CAS 6047-71-8

(E)-amino[(naphthalen-1-ylmethyl)imino]methanaminium chloride

Description:

(E)-amino[(naphthalen-1-ylmethyl)imino]methanaminium chloride, with the CAS number 6047-71-8, is a chemical compound characterized by its unique structural features. It contains an amino group and an imino linkage, which contribute to its potential as a ligand in coordination chemistry. The presence of the naphthalenylmethyl group enhances its aromatic character, potentially influencing its solubility and reactivity. This compound is typically encountered as a chloride salt, which can affect its stability and interaction with other substances. Its molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Overall, (E)-amino[(naphthalen-1-ylmethyl)imino]methanaminium chloride represents a fascinating subject for study due to its complex structure and potential applications in various fields of chemistry.

Formula: C₁₂H₁₄ClN₃

InChI: InChI=1/C12H13N3.ClH/c13-12(14)15-8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H4,13,14,15);1H

Synonyms:

• 1-(1-Naphthylmethyl)guanidine hydrochloride (1:1)
• guanidine, N-(1-naphthalenylmethyl)-, hydrochloride (1:1)

N-[(Naphthalen-1-yl)methyl]guanidine hydrochloride

CAS: 6047-71-8

Versatile small molecule scaffold

Formula: C₁₂H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 235.71 g/mol

Ref: 3D-GAA04771