CAS 605-59-4
:Quinolinium, 1-ethyl-4-methyl-, iodide (1:1)
Description:
Quinolinium, 1-ethyl-4-methyl-, iodide (1:1), with the CAS number 605-59-4, is a quaternary ammonium compound characterized by its structure, which includes a quinolinium ring substituted with an ethyl group at the nitrogen and a methyl group at the 4-position. This compound typically appears as a solid or crystalline substance and is known for its ionic nature due to the presence of the iodide ion. Quinolinium derivatives often exhibit interesting biological activities, including antimicrobial and antitumor properties, making them of interest in medicinal chemistry. The iodide component contributes to its solubility in polar solvents and can influence its reactivity and interaction with biological systems. Additionally, the presence of the ethyl and methyl groups can affect the compound's lipophilicity and overall pharmacokinetic profile. As with many quaternary ammonium compounds, safety and handling precautions are necessary due to potential toxicity and environmental impact.
Formula:C12H14N·I
InChI:InChI=1S/C12H14N.HI/c1-3-13-9-8-10(2)11-6-4-5-7-12(11)13;/h4-9H,3H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=VQDKCFLPUPEBJC-UHFFFAOYSA-M
SMILES:C(C)[N+]=1C2=C(C(C)=CC1)C=CC=C2.[I-]
Synonyms:- 1-Ethyl-4-Methylquinolinium
- 1-Ethyllepidinium iodide
- 4-Methylquinoline ethiodide
- Lepidine ethiodide
- Lepidinium ethiodide
- Lepidinium, 1-ethyl-, iodide
- N-Ethyllepidinium iodide
- Nsc 204954
- Quinolinium, 1-ethyl-4-methyl-, iodide
- Quinolinium, 1-ethyl-4-methyl-, iodide (1:1)
- 1-Ethyl-4-methylquinolinium iodide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Ethyl-4-methylquinolin-1-ium iodide
CAS:1-Ethyl-4-methylquinolin-1-ium iodidePurity:97%Molecular weight:299.15g/mol1-Ethyl-4-methylquinoliniumiodide
CAS:1-Ethyl-4-methylquinoliniumiodide is a reactive compound that is used in the production of optical brighteners. It reacts with cellulose acetate to form a fluorescent product, which emits light when exposed to ultraviolet light. This compound also reacts with fatty acids to produce a fluorescent product, which can be used as an indicator for the presence of vinylene or other alkenes. 1-Ethyl-4-methylquinoliniumiodide has also been shown to react with nitrogen atoms and carbon tetrachloride to form an active methylene group, which is used as a starting point for the synthesis of dihydro derivatives. The optical properties of this compound are dependent on its environment.Formula:C12H14INPurity:Min. 95%Molecular weight:299.15 g/mol



