CAS 605-60-7
:4-Nitroso-1-naphthalenol
Description:
4-Nitroso-1-naphthalenol, with the CAS number 605-60-7, is an organic compound characterized by its nitroso and hydroxyl functional groups attached to a naphthalene ring. This compound typically appears as a solid and is known for its distinctive yellow to orange color. It is soluble in organic solvents but has limited solubility in water. The presence of the nitroso group imparts unique reactivity, allowing it to participate in various chemical reactions, including electrophilic substitutions and reductions. 4-Nitroso-1-naphthalenol is often used in organic synthesis and as an intermediate in the production of dyes and pigments. Additionally, it exhibits potential biological activity, which has been the subject of research in medicinal chemistry. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings. Overall, 4-Nitroso-1-naphthalenol is a versatile compound with applications in both industrial and research contexts.
Formula:C10H7NO2
InChI:InChI=1S/C10H7NO2/c12-10-6-5-9(11-13)7-3-1-2-4-8(7)10/h1-6,12H
InChI key:InChIKey=ZVNOVIBCAIDQOE-UHFFFAOYSA-N
SMILES:N(=O)C=1C2=C(C(O)=CC1)C=CC=C2
Synonyms:- 1-Naphthalenol, 4-nitroso-
- 1-Nitroso-4-naphthalenol
- 4-Nitroso-1-naphthalenol
- 1-Naphthol, 4-nitroso-
- 4-Nitroso-1-naphthol
- 4-07-00-02424 (Beilstein Handbook Reference)
- 4-nitrosonaphthalen-1-ol
- BRN 1946063
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Nitrosonaphthalen-1-ol
CAS:4-Nitrosonaphthalen-1-ol is a chemical compound that can be used as an immunosorbent in diagnostic assays. It has been shown to react with parathyroid hormone and to have a detection sensitivity of 2.5 pg/mL in immunoassays. 4-Nitrosonaphthalen-1-ol is also used for the detection of nitric oxide by electrochemical biosensors, with a detection limit of 0.4 μM and a reaction rate of 10 seconds. The technique is most sensitive to metal ions such as Cu2+, Ni2+, Zn2+, and Mn2+. 4NOS has been shown to bind to the membrane of cells at nanomolar concentrations, making it useful for molecular probes, low detection, and nanomaterials.Formula:C10H7NO2Purity:Min. 95%Molecular weight:173.17 g/mol
