CAS 605-70-9: 1,4-Naphthalenedicarboxylic acid
Description:1,4-Naphthalenedicarboxylic acid, with the CAS number 605-70-9, is an organic compound characterized by its structure, which features two carboxylic acid groups attached to a naphthalene ring at the 1 and 4 positions. This compound appears as a white to off-white crystalline solid and is known for its relatively high melting point. It is soluble in polar solvents such as water and alcohols, but less so in non-polar solvents. 1,4-Naphthalenedicarboxylic acid is utilized in various applications, including the synthesis of polymers, particularly in the production of high-performance materials and as a precursor for dyes and pharmaceuticals. The compound exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds, which contributes to its solubility and reactivity. Additionally, it can undergo various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Its environmental impact and safety profile should be considered, as with all chemical substances, during handling and application.
Formula:C12H8O4
InChI:InChI=1S/C12H8O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h1-6H,(H,13,14)(H,15,16)
InChI key:InChIKey=ABMFBCRYHDZLRD-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C(=O)O)C=2C=CC=CC12
- Synonyms:
- 1,4-Dicarboxynaphthalene
- 1,4-Naphthalenedicarboxylic acid
