CymitQuimica logo

CAS 60505-02-4

:

Benzenebutanoic acid, a-(acetylamino)-

Description:
Benzenebutanoic acid, a-(acetylamino)-, also known by its CAS number 60505-02-4, is an organic compound characterized by its structure, which includes a benzene ring, a butanoic acid moiety, and an acetylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic benzene ring. The presence of the acetylamino group introduces polar characteristics, which can enhance its reactivity and potential interactions in biological systems. Benzenebutanoic acid derivatives are often studied for their potential pharmaceutical applications, particularly in the development of anti-inflammatory or analgesic agents. The compound's functional groups allow for various chemical reactions, including acylation and amide formation, making it a versatile intermediate in organic synthesis. As with many organic acids, it may exhibit acidic properties, contributing to its behavior in different pH environments. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-9(14)13-11(12(15)16)8-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,13,14)(H,15,16)
InChI key:CNQZAOFOKXXEOB-UHFFFAOYSA-N
SMILES:CC(=O)NC(CCC1=CC=CC=C1)C(=O)O
Found 5 products.