CAS 60509-43-5

N-Butyl-3-methylbenzenemethanamine

Description:

N-Butyl-3-methylbenzenemethanamine, with the CAS number 60509-43-5, is an organic compound that belongs to the class of amines. It features a butyl group attached to a benzene ring that is further substituted with a methyl group and an amine functional group. This compound is characterized by its hydrophobic nature due to the presence of the butyl group, which contributes to its solubility in organic solvents while being less soluble in water. The presence of the amine group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its structural features suggest potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Safety data should be consulted for handling and usage, as amines can be irritants and may pose health risks if not managed properly.

Formula: C₁₂H₁₉N

InChI: InChI=1S/C12H19N/c1-3-4-8-13-10-12-7-5-6-11(2)9-12/h5-7,9,13H,3-4,8,10H2,1-2H3

InChI key: InChIKey=WCFIZXRUMMCIQK-UHFFFAOYSA-N

SMILES: C(NCCCC)C1=CC(C)=CC=C1

Synonyms:

• Benzenemethanamine, N-butyl-3-methyl-
• N-Butyl-3-methylbenzylamine
• N-Butyl-3-methylbenzenemethanamine

butyl[(3-methylphenyl)methyl]amine

CAS: 60509-43-5

Formula: C₁₂H₁₉N

Purity: 95.0%

Molecular weight: 177.291

Ref: 10-F523110