CymitQuimica logo

CAS 60511-85-5

:

11,12-Dihydroindolo[2,3-a]carbazole

Description:
11,12-Dihydroindolo[2,3-a]carbazole is a polycyclic aromatic compound characterized by its fused indole and carbazole structures. This compound features a bicyclic framework that contributes to its unique chemical properties, including potential biological activity. It is typically a solid at room temperature and exhibits a relatively high melting point, indicative of strong intermolecular interactions. The presence of nitrogen atoms in its structure can influence its reactivity and solubility in various solvents. This compound is of interest in organic synthesis and materials science, particularly for its potential applications in organic electronics and as a building block in the development of novel pharmaceuticals. Additionally, its structural features may impart interesting photophysical properties, making it a candidate for studies in photochemistry and photophysics. However, due to its complex structure, the synthesis and characterization of 11,12-Dihydroindolo[2,3-a]carbazole can be challenging, requiring specialized techniques in organic chemistry.
Formula:C18H12N2
InChI:InChI=1/C18H12N2/c1-3-7-15-11(5-1)13-9-10-14-12-6-2-4-8-16(12)20-18(14)17(13)19-15/h1-10,19-20H
SMILES:c1ccc2c(c1)c1ccc3c4ccccc4[nH]c3c1[nH]2
Synonyms:
  • 11,12-Dihydroindolo[2,3-a]carbazol
  • Indolo[2,3-A]Carbazole, 11,12-Dihydro-
  • 11,12-Dihyrdoindolo[2,3-A]Carbazole
  • 11,12-Dihydroindolo[2,3-a]-carbazole
Found 5 products.