CAS 6052-75-1
:2-hydroxy-1,6-dimethylpyridin-4(1H)-one
Description:
2-Hydroxy-1,6-dimethylpyridin-4(1H)-one, also known as 4-hydroxy-1,6-dimethylpyridin-2(1H)-one, is a heterocyclic organic compound characterized by a pyridine ring substituted with hydroxyl and methyl groups. This compound features a hydroxyl group (-OH) at the 2-position and two methyl groups (-CH3) at the 1 and 6 positions of the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry, where it may exhibit biological activity, and in the synthesis of other organic compounds. Its structure allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the presence of the dimethyl groups can affect its lipophilicity and overall stability. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-5-3-6(9)4-7(10)8(5)2/h3-4,10H,1-2H3
SMILES:Cc1cc(=O)cc(n1C)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-hydroxy-1,6-dimethyl-2(1H)-pyridinone
CAS:Formula:C7H9NO2Purity:97%Color and Shape:SolidMolecular weight:139.15194-Hydroxy-1,6-Dimethyl-1H-Pyridin-2-One
CAS:4-Hydroxy-1,6-dimethyl-1H-pyridin-2-one is a heterocyclic compound that is used as an intermediate in the synthesis of other compounds. It has been shown to have antiproliferative activity against human tumor cells and induces apoptosis. This compound also has anti-inflammatory properties and can be used as a substitute for malononitrile in the synthesis of cytotoxic drugs. 4-Hydroxy-1,6-dimethyl-1H-pyridin-2-one is synthesized by cyclocondensation reaction between cyanate and sulfinyl chlorides. The yield of this compound can be increased with the use of a Lewis acid such as aluminum chloride or zinc chloride.Formula:C7H9NO2Purity:Min. 95%Molecular weight:139.15 g/mol


