CAS 60524-14-3

5-aminopyridine-3-carboxamide

Description:

5-Aminopyridine-3-carboxamide, with the CAS number 60524-14-3, is an organic compound characterized by its pyridine ring structure, which is substituted with an amino group and a carboxamide group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxamide functional group, which can engage in hydrogen bonding. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. 5-Aminopyridine-3-carboxamide is of interest in medicinal chemistry and may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals. Its structural features suggest that it could interact with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.

Formula: C₆H₇N₃O

InChI: InChI=1/C6H7N3O/c7-5-1-4(6(8)10)2-9-3-5/h1-3H,7H2,(H2,8,10)

SMILES: c1c(cncc1N)C(=N)O

Synonyms:

• 5-Amino-3-pyridinecarboxamide
• 3-Pyridinecarboxamide, 5-Amino-
• 5-Aminonicotinamide

5-Amino-3-pyridinecarboxamide

CAS: 60524-14-3

Formula: C₆H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 137.1393

Ref: IN-DA003MEF

5-Amino-3-Pyridinecarboxamide

CAS: 60524-14-3

5-Amino-3-Pyridinecarboxamide

Purity: 97%

Molecular weight: 137.14g/mol

Ref: 54-OR1011808

5-Amino-3-pyridinecarboxamide

CAS: 60524-14-3

Formula: C₆H₇N₃O

Purity: 95%

Color and Shape: Solid, Off-white powder

Molecular weight: 137.142

Ref: 10-F076704