CAS 6053-68-5
:Tetrahydro-1H-cyclopenta[1,2-c:3,4-c′]difuran-1,3,4,6(3aH)-tetrone
Description:
Tetrahydro-1H-cyclopenta[1,2-c:3,4-c′]difuran-1,3,4,6(3aH)-tetrone, with CAS number 6053-68-5, is a bicyclic organic compound characterized by its unique fused ring structure, which includes two furan rings and a cyclopentane moiety. This compound typically exhibits a range of chemical properties, including potential reactivity due to the presence of multiple carbonyl groups, which can participate in various chemical reactions such as nucleophilic addition or condensation. Its structure suggests it may have interesting electronic properties, possibly making it a candidate for applications in organic electronics or as a building block in synthetic organic chemistry. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as temperature and light. Additionally, due to its complex structure, it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological potential. Overall, Tetrahydro-1H-cyclopenta[1,2-c:3,4-c′]difuran-1,3,4,6(3aH)-tetrone represents a fascinating subject for further research in both synthetic and medicinal chemistry.
Formula:C9H6O6
InChI:InChI=1S/C9H6O6/c10-6-2-1-3-5(4(2)8(12)14-6)9(13)15-7(3)11/h2-5H,1H2
InChI key:InChIKey=NLWBEORDOPDUPM-UHFFFAOYSA-N
SMILES:O=C1C2C3C(CC2C(=O)O1)C(=O)OC3=O
Synonyms:- (3aR,3bS,6aS,7aR)-tetrahydro-1H-cyclopenta[1,2-c:3,4-c']difuran-1,3,4,6(3aH)-tetrone
- 1,2,3,4-Cyclopentanetetracarboxylic 1,2:3,4-dianhydride
- 1,2,3,4-Cyclopentanetetracarboxylic acid dianhydride
- 1H-Cyclopenta(1,2-c:3,4-c')difuran-1,3,4,6(3aH)-tetrone, tetrahydro-
- r-1,c-2,c-3,c-4-Cyclopentane-1,2:3,4-tetracarboxylic dianhydride
- tetrahydro-1H-cyclopenta[1,2-c:3,4-c']difuran-1,3,4,6(3aH)-tetrone
- 1,2,3,4-Cyclopentanetetracarboxylic dianhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,3,4-Cyclopentanetetracarboxylic Dianhydride
CAS:Formula:C9H6O6Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:210.14Dihydro-1H-cyclopenta[1,2-c:3,4-c']difuran-1,3,4,6(3aH,3bH,6aH)-tetraone
CAS:Formula:C9H6O6Purity:98%Color and Shape:SolidMolecular weight:210.1403Dihydro-1H-Cyclopenta[1,2-C:3,4-C’]Difuran-1,3,4,6(3Ah,3Bh,6Ah)-Tetraone
CAS:Dihydro-1H-Cyclopenta[1,2-C:3,4-C’]Difuran-1,3,4,6(3Ah,3Bh,6Ah)-TetraonePurity:98%Molecular weight:210.14g/mol1,2,3,4-Cyclopentanetetracarboxylic Dianhydride (purified by sublimation)
CAS:Formula:C9H6O6Purity:>99.0%(T)Color and Shape:White powder to crystalMolecular weight:210.14Dihydro-1H-cyclopenta[1,2-c:3,4-c’]difuran-1,3,4,6(3aH,3bH,6aH)-tetraone
CAS:Formula:C9H6O6Purity:98%Color and Shape:Liquid, No data available.Molecular weight:210.1411,2,3,4-Cyclopentanetetracarboxylic dianhydride
CAS:1,2,3,4-Cyclopentanetetracarboxylic dianhydride (CPCD) is a cycloaliphatic compound that has been used to prepare polymers with azobenzene groups. These polymers can be used as photocrosslinkable materials in the preparation of films and coatings. The polymerization reaction of CPCD is irreversible and cyclic oxidation occurs at high temperatures. The synthesis of these polymers is carried out in polar solvents such as dichloromethane or chloroform.
Formula:C9H6O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:210.14 g/molRef: 3D-FC62714
Discontinued product




