CAS 60539-23-3: Oleoside 11-methyl ester
Description:Oleoside 11-methyl ester, identified by its CAS number 60539-23-3, is a chemical compound that belongs to the class of glycosides, specifically a type of oleoside. It is derived from oleic acid and is characterized by its ester functional group, which contributes to its solubility and reactivity. This compound typically exhibits properties such as being a colorless to pale yellow liquid, with a pleasant odor. Oleoside 11-methyl ester is known for its potential applications in the food and cosmetic industries due to its emollient and moisturizing properties. Additionally, it may possess bioactive characteristics, making it of interest in pharmacological research. Its stability and compatibility with various formulations make it a valuable ingredient in product development. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, ensuring proper safety measures are taken during its use.
Formula:C17H24O11
InChI:InChI=1S/C17H24O11/c1-3-7-8(4-11(19)20)9(15(24)25-2)6-26-16(7)28-17-14(23)13(22)12(21)10(5-18)27-17/h3,6,8,10,12-14,16-18,21-23H,4-5H2,1-2H3,(H,19,20)/b7-3+/t8-,10+,12+,13-,14+,16-,17-/m0/s1
InChI key:InChIKey=XSCVKBFEPYGZSL-JYVCFIOWSA-N
SMILES:O=C(O)CC1C(=COC(OC2OC(CO)C(O)C(O)C2O)C1=CC)C(=O)OC
- Synonyms:
- Methyloleoside
- Oleoside 11-methyl ester
- 2H-Pyran-4-acetic acid, 3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, (2S,3E,4S)-
- (2S,3E,4S)-3-Ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-2H-pyran-4-acetic acid
- 2H-Pyran-4-acetic acid, 3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, [2S-(2α,3E,4β)]-
