CAS 6054-10-0
:N'-[(Z)-3H-indol-3-ylidenemethyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide
Description:
The chemical substance N'-[(Z)-3H-indol-3-ylidenemethyl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide, with CAS number 6054-10-0, is a complex organic compound characterized by its unique structural features. It contains an indole moiety, which is known for its aromatic properties and biological significance, particularly in pharmaceuticals. The presence of a pyrrolidine ring contributes to its cyclic structure, while the hydrazide functional group enhances its reactivity and potential for forming hydrogen bonds. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its methoxyphenyl substituent can influence its solubility and interaction with biological targets. The Z configuration of the indole-ylidene group suggests specific stereochemical properties that may affect its biological activity and binding affinity. Overall, this compound's intricate structure and functional groups suggest potential applications in drug development and research, particularly in areas related to cancer and neurodegenerative diseases, although specific biological activities would require further investigation.
Formula:C21H20N4O3
InChI:InChI=1/C21H20N4O3/c1-28-17-8-6-16(7-9-17)25-13-14(10-20(25)26)21(27)24-23-12-15-11-22-19-5-3-2-4-18(15)19/h2-9,11-12,14,23H,10,13H2,1H3,(H,24,27)/b15-12+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Braylin
CAS:Braylin has anti-inflammatory, antinociceptive and immunomodulatory effects, which possibly act through the glucocorticoid receptor activation and by inhibitionFormula:C15H14O4Purity:98%Color and Shape:SolidMolecular weight:258.27Braylin
CAS:Braylin is an innovative polymer material, which is synthesized from a unique formulation of advanced macromolecules. This product is developed using a proprietary chemical process that involves the polymerization of monomers with specific side-chain functionalities. The result is a versatile polymer with dynamic and reversible adhesive properties, achieved through non-covalent interactions, such as hydrogen bonding and Van der Waals forces.
Formula:C15H14O4Purity:Min. 95%Molecular weight:258.27 g/mol


