CAS 60546-62-5

6-bromo-1,3-benzodioxole-5-carboxylic acid

Description:

6-Bromo-1,3-benzodioxole-5-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and a carboxylic acid functional group. The presence of the bromine atom at the 6-position of the benzodioxole ring contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a white to off-white solid and is soluble in polar solvents, which facilitates its use in organic synthesis and medicinal chemistry. The carboxylic acid group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 60546-62-5, is a unique identifier that aids in the cataloging and retrieval of information related to this substance in chemical databases. Overall, 6-bromo-1,3-benzodioxole-5-carboxylic acid is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₈H₅BrO₄

InChI: InChI=1/C8H5BrO4/c9-5-2-7-6(12-3-13-7)1-4(5)8(10)11/h1-2H,3H2,(H,10,11)

SMILES: c1c(c(cc2c1OCO2)Br)C(=O)O

Synonyms:

• 1,3-Benzodioxole-5-Carboxylic Acid, 6-Bromo-
• Acide 6-bromo-1,3-benzodioxole-5-carboxylique
• 6-Bromobenzo[D][1,3]Dioxole-5-Carboxylic Acid

6-Bromo-3,4-methylenedioxybenzoic acid

CAS: 60546-62-5

Formula: C₈H₅BrO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 245.0269

Ref: IN-DA00EAC9

6-Bromo-3,4-methylenedioxybenzoic acid

CAS: 60546-62-5

6-Bromo-3,4-methylenedioxybenzoic acid

Formula: C₈H₅BrO₄

Purity: ≥95%

Color and Shape: white/off-white powder

Molecular weight: 245.03g/mol

Ref: 54-OR345600

6-Bromobenzo-(1,3)-dioxole-5-carboxylic acid

CAS: 60546-62-5

6-Bromobenzo-(1,3)-dioxole-5-carboxylic acid is a natural product that is synthesised by the reaction of hydrochloric acid with bromobenzene and dioxolane. It has been used as an intermediate in the synthesis of carbaryl, which is used as an insecticide. 6-Bromobenzo-(1,3)-dioxole-5-carboxylic acid has also been shown to inhibit the biosynthesis of berberine in plants. This compound can be synthesized by reacting noradrenaline with hydrobromic acid or deuterium oxide.

Formula: C₈H₅BrO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 245.03 g/mol

Ref: 3D-FB69999

6-Bromobenzo[d][1,3]dioxole-5-carboxylic acid

CAS: 60546-62-5

Purity: 96%

Molecular weight: 245.0279999

Ref: 10-F616221