CAS 6056-42-4

2H-Pyrido[1,2-a]pyrimidin-3-ol, 3,4-dihydro-7-methyl-, hydrochloride (1:1)

Description:

2H-Pyrido[1,2-a]pyrimidin-3-ol, 3,4-dihydro-7-methyl-, hydrochloride (1:1), with the CAS number 6056-42-4, is a chemical compound characterized by its bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity. The presence of a hydroxyl group (-OH) at the 3-position and a methyl group at the 7-position contributes to its chemical reactivity and solubility in polar solvents. As a hydrochloride salt, it is often more stable and soluble in aqueous solutions compared to its free base form. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, it may exhibit various interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₁₂N₂O·ClH

InChI: InChI=1S/C9H12N2O.ClH/c1-7-2-3-9-10-4-8(12)6-11(9)5-7;/h2-3,5,8,12H,4,6H2,1H3;1H

InChI key: InChIKey=WDPCJEZZJHUBMS-UHFFFAOYSA-N

SMILES: OC1CN2C(C=CC(C)=C2)=NC1.Cl

Synonyms:

• 2H-Pyrido[1,2-a]pyrimidin-3-ol, 3,4-dihydro-7-methyl-, hydrochloride
• 2H-Pyrido[1,2-a]pyrimidin-3-ol, 3,4-dihydro-7-methyl-, hydrochloride (1:1)

7-Methyl-2H,3H,4H-pyrido[1,2-a]pyrimidin-3-ol hydrochloride

CAS: 6056-42-4

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 200.66 g/mol

Ref: 3D-GAA05642