CAS 60573-59-3
:1,2-Dihydro-8-methoxynaphthalene
Description:
1,2-Dihydro-8-methoxynaphthalene, with the CAS number 60573-59-3, is an organic compound belonging to the naphthalene family. It features a naphthalene core structure that is partially saturated, indicating the presence of two hydrogen atoms added to the naphthalene ring system, which typically consists of two fused aromatic rings. The methoxy group (-OCH3) at the 8-position contributes to its chemical properties, influencing its reactivity and solubility. This compound is likely to exhibit hydrophobic characteristics due to its aromatic nature, making it less soluble in water but more soluble in organic solvents. Its structure suggests potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, the presence of the methoxy group can affect its electronic properties, potentially making it useful in materials science or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C11H12O
InChI:InChI=1S/C11H12O/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2,4-6,8H,3,7H2,1H3
InChI key:InChIKey=WEYWMYUBBQDNDR-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=C1)C=CCC2
Synonyms:- 1,2-Dihydro-8-methoxynaphthalene
- Naphthalene, 1,2-dihydro-8-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

